Products 177615-96-2

CAS 177615-96-2 is the registry number for 2-tert-Butyl 5-methyl 4,5,6,7-tetrahydro-1h-isoindole-2,5(3h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate (CAS 177615-96-2) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate. InChIKey: BJSZXFACHLOTAC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO4
Molecular weight281.35 g/mol
IUPAC name2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate
InChIKeyBJSZXFACHLOTAC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2=C(C1)CC(CC2)C(=O)OC

Computed by PubChem (NCBI)