CAS 177615-96-2 is the registry number for 2-tert-Butyl 5-methyl 4,5,6,7-tetrahydro-1h-isoindole-2,5(3h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate (CAS 177615-96-2) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate. InChIKey: BJSZXFACHLOTAC-UHFFFAOYSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl 1,3,4,5,6,7-hexahydroisoindole-2,5-dicarboxylate |
| InChIKey | BJSZXFACHLOTAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)CC(CC2)C(=O)OC |
Computed by PubChem (NCBI)