cas: 850567-25-8 — see every product listed under this CAS number, including other names
3-(Cyclohexylaminocarbonyl)phenylboronic acid, 96%, 96% (CAS 850567-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G465-1g |
| cas | 850567-25-8 |
| size | 1g |
| availability | 9.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 371.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[3-(cyclohexylcarbamoyl)phenyl]boronic acid (CAS 850567-25-8) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: [3-(cyclohexylcarbamoyl)phenyl]boronic acid. InChIKey: PZOTXXRWCKDMBC-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | [3-(cyclohexylcarbamoyl)phenyl]boronic acid |
| InChIKey | PZOTXXRWCKDMBC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)