cas: 1629971-64-7 — see every product listed under this CAS number, including other names
3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid 98% (CAS 1629971-64-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A502716-250mg |
| cas | 1629971-64-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 25g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A502716 |
(3-cyclopentyloxy-2,4-difluorophenyl)boronic acid (CAS 1629971-64-7) is a chemical compound with the molecular formula C11H13BF2O3 and a molecular weight of 242.03 g/mol. IUPAC name: (3-cyclopentyloxy-2,4-difluorophenyl)boronic acid. InChIKey: QVOMZLGWOQDLEB-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | (3-cyclopentyloxy-2,4-difluorophenyl)boronic acid |
| InChIKey | QVOMZLGWOQDLEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC2CCCC2)F)(O)O |
Computed by PubChem (NCBI)