CAS 2096331-93-8 appears in our catalog under these names: 4-(Cyclopentyloxy)-3,5-difluorophenylboronic acid, 95%, (4-(Cyclopentyloxy)-3,5-difluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(4-cyclopentyloxy-3,5-difluorophenyl)boronic acid (CAS 2096331-93-8) is a chemical compound with the molecular formula C11H13BF2O3 and a molecular weight of 242.03 g/mol. IUPAC name: (4-cyclopentyloxy-3,5-difluorophenyl)boronic acid. InChIKey: PAJFMJQOJXZCLX-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | (4-cyclopentyloxy-3,5-difluorophenyl)boronic acid |
| InChIKey | PAJFMJQOJXZCLX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC2CCCC2)F)(O)O |
Computed by PubChem (NCBI)