CAS 1629971-64-7 appears in our catalog under these names: 3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid, 98%, 3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid 98%, 3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g.
(3-cyclopentyloxy-2,4-difluorophenyl)boronic acid (CAS 1629971-64-7) is a chemical compound with the molecular formula C11H13BF2O3 and a molecular weight of 242.03 g/mol. IUPAC name: (3-cyclopentyloxy-2,4-difluorophenyl)boronic acid. InChIKey: QVOMZLGWOQDLEB-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | (3-cyclopentyloxy-2,4-difluorophenyl)boronic acid |
| InChIKey | QVOMZLGWOQDLEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC2CCCC2)F)(O)O |
Computed by PubChem (NCBI)