cas: 959850-87-4 — see every product listed under this CAS number, including other names
3-(Cyclopentyloxy)phenylboronic acid, 97%, 97% (CAS 959850-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1170NN-100mg |
| cas | 959850-87-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1302.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-cyclopentyloxyphenyl)boronic acid (CAS 959850-87-4) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: (3-cyclopentyloxyphenyl)boronic acid. InChIKey: CGJBKPGDQSBMIY-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | (3-cyclopentyloxyphenyl)boronic acid |
| InChIKey | CGJBKPGDQSBMIY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC2CCCC2)(O)O |
Computed by PubChem (NCBI)