cas: 5250-02-2 — see every product listed under this CAS number, including other names
3-(DIMETHYLAMINO)-1-(4-METHYLPHENYL)PROPAN-1-ONE HCL (CAS 5250-02-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386970-1G |
| cas | 5250-02-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3387.37 Pln | |
| Fluorochem | 25g | 8120.08 Pln |
| delivery time | 3-4 weeks |
|---|
3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 5250-02-2) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: SDNGTEVPTBGTKK-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | SDNGTEVPTBGTKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CCN(C)C.Cl |
Computed by PubChem (NCBI)