cas: 916326-10-8 — see every product listed under this CAS number, including other names
3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester, 96% (CAS 916326-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221926-1G |
| cas | 916326-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1674.43 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 916326-10-8) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: ZKGQTSJZFBTEOB-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | ZKGQTSJZFBTEOB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)OCC |
Computed by PubChem (NCBI)