3-(Ethylsulfonyl)aniline, 96%
cas: 83164-93-6 — see every product listed under this CAS number, including other names
3-(Ethylsulfonyl)aniline, 96% (CAS 83164-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A391236-250mg |
| cas | 83164-93-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2979.19 Pln | |
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 2099.60 Pln | |
| Chemat | 5g | 7192.40 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 897.49 Pln | |
| BLDpharm | 5g | 3207.78 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
3-ethylsulfonylaniline (CAS 83164-93-6) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 3-ethylsulfonylaniline. InChIKey: ZCIQLGLOYPISKI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 3-ethylsulfonylaniline |
| InChIKey | ZCIQLGLOYPISKI-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)