cas: 72679-97-1 — see every product listed under this CAS number, including other names
3-(Hydroxymethyl)benzo[d]thiazol-2(3H)-one 98% (CAS 72679-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195517-100mg |
| cas | 72679-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1126.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A195517 |
3-(hydroxymethyl)-1,3-benzothiazol-2-one (CAS 72679-97-1) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 3-(hydroxymethyl)-1,3-benzothiazol-2-one. InChIKey: QGEJJONTBKAEKC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-(hydroxymethyl)-1,3-benzothiazol-2-one |
| InChIKey | QGEJJONTBKAEKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)S2)CO |
Computed by PubChem (NCBI)