cas: 695215-94-2 — see every product listed under this CAS number, including other names
3-(Methoxycarbonyl)-5-(N-methylmethylsulfonamido)benzoic acid, 95% (CAS 695215-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722907-100MG |
| cas | 695215-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1216.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxycarbonyl-5-[methyl(methylsulfonyl)amino]benzoic acid (CAS 695215-94-2) is a chemical compound with the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. IUPAC name: 3-methoxycarbonyl-5-[methyl(methylsulfonyl)amino]benzoic acid. InChIKey: FLJKJNQTDSNBLQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 3-methoxycarbonyl-5-[methyl(methylsulfonyl)amino]benzoic acid |
| InChIKey | FLJKJNQTDSNBLQ-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC(=C1)C(=O)OC)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)