CAS 91134-85-9 appears in our catalog under these names: 2-Hydroxy-5-(morpholine-4-sulfonyl)-benzoic acid, 95%, 2-Hydroxy-5-(morpholin-4-ylsulfonyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-hydroxy-5-morpholin-4-ylsulfonylbenzoic acid (CAS 91134-85-9) is a chemical compound with the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. IUPAC name: 2-hydroxy-5-morpholin-4-ylsulfonylbenzoic acid. InChIKey: IVYVLEQZZGWQTF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 2-hydroxy-5-morpholin-4-ylsulfonylbenzoic acid |
| InChIKey | IVYVLEQZZGWQTF-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)