CAS 306278-42-2 appears in our catalog under these names: N-(2,3-Dihydro-1,4-benzodioxin-6-ylsulfonyl)-b-alanine, 95%, N-(2,3-Dihydro-1,4-benzodioxin-6-ylsulfonyl)-alanine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10g, 0,5g.
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoic acid (CAS 306278-42-2) is a chemical compound with the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoic acid. InChIKey: MBRBEMMVLHFBCE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoic acid |
| InChIKey | MBRBEMMVLHFBCE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)