cas: 1100052-63-8 — see every product listed under this CAS number, including other names
3-(Methoxycarbonyl)indole-5-boronic acid pinacol ester, 97%, 97% (CAS 1100052-63-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBNM-100mg |
| cas | 1100052-63-8 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1792.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate (CAS 1100052-63-8) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate. InChIKey: GBJXMSNMGSGQFL-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate |
| InChIKey | GBJXMSNMGSGQFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC=C3C(=O)OC |
Computed by PubChem (NCBI)