CAS 1072811-67-6 appears in our catalog under these names: 4-Methoxycarbonylindole-2-boronic acid pinacol ester, 95%, Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate 95%, 4-Methoxycarbonylindole-2-boronic acid pinacol ester, 95%, 95%, Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate (CAS 1072811-67-6) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate. InChIKey: DBUOXHIKCAIAHS-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate |
| InChIKey | DBUOXHIKCAIAHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC=C3N2)C(=O)OC |
Computed by PubChem (NCBI)