Products 2098425-28-4
CAS 2098425-28-4 is the registry number for Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-7-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-7-carboxylate (CAS 2098425-28-4) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-7-carboxylate. InChIKey: KKPKAZNDWGCMRR-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-7-carboxylate |
| InChIKey | KKPKAZNDWGCMRR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CNC3=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)