cas: 22821-75-6 — see every product listed under this CAS number, including other names
3-(Methylsulfonyl)benzonitrile 98% (CAS 22821-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237031-1g |
| cas | 22821-75-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 331.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237031 |
3-methylsulfonylbenzonitrile (CAS 22821-75-6) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 3-methylsulfonylbenzonitrile. InChIKey: VWPJXEYDYJQMBC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-methylsulfonylbenzonitrile |
| InChIKey | VWPJXEYDYJQMBC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)