cas: 723281-57-0 — see every product listed under this CAS number, including other names
3-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid (CAS 723281-57-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219484-5G |
| cas | 723281-57-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1065.27 Pln |
| delivery time | 3-4 weeks |
|---|
[3-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 723281-57-0) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: [3-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: IYZAWDLXZOCCSB-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | [3-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | IYZAWDLXZOCCSB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(C)OC)(O)O |
Computed by PubChem (NCBI)