CAS 1451391-90-4 appears in our catalog under these names: 4-(Methylcarbamoyl)-2-methoxyphenylboronic acid, 95%, (2-Methoxy-4-(methylcarbamoyl)phenyl)boronic acid, 98%, (2-Methoxy-4-(methylcarbamoyl)phenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g.
[2-methoxy-4-(methylcarbamoyl)phenyl]boronic acid (CAS 1451391-90-4) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: [2-methoxy-4-(methylcarbamoyl)phenyl]boronic acid. InChIKey: ZSPSEMZFBHOFIX-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | [2-methoxy-4-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | ZSPSEMZFBHOFIX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC)OC)(O)O |
Computed by PubChem (NCBI)