Products 723281-57-0
CAS 723281-57-0 appears in our catalog under these names: 3-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid, 98%, 3–(N，O–Dimethylhydroxylaminocarbonyl)phenylboronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 100mg.
[3-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 723281-57-0) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: [3-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: IYZAWDLXZOCCSB-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | [3-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | IYZAWDLXZOCCSB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(C)OC)(O)O |
Computed by PubChem (NCBI)