cas: 1170019-97-2 — see every product listed under this CAS number, including other names
3-(N-BOC-METHYLAMINOMETHYL)AZETIDINE HCL, 98% (CAS 1170019-97-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468243-100MG |
| cas | 1170019-97-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 500mg | 1382.86 Pln | |
| Fluorochem | 1g | 2044.09 Pln | |
| Fluorochem | 5g | 5980.20 Pln | |
| Fluorochem | 10g | 10410.94 Pln | |
| Fluorochem | 25g | 20740.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate;hydrochloride (CAS 1170019-97-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate;hydrochloride. InChIKey: NPZOOGZMCGJGTO-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate;hydrochloride |
| InChIKey | NPZOOGZMCGJGTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1CNC1.Cl |
Computed by PubChem (NCBI)