cas: 887344-35-6 — see every product listed under this CAS number, including other names
3-(Pyrazin-2-yl)benzaldehyde, 98% (CAS 887344-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691265-100MG |
| cas | 887344-35-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 1346.42 Pln | |
| Fluorochem | 5g | 4574.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-pyrazin-2-ylbenzaldehyde (CAS 887344-35-6) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 3-pyrazin-2-ylbenzaldehyde. InChIKey: CLHDOSZCXSKSSD-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3-pyrazin-2-ylbenzaldehyde |
| InChIKey | CLHDOSZCXSKSSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CN=C2)C=O |
Computed by PubChem (NCBI)