cas: 262852-11-9 — see every product listed under this CAS number, including other names
3-(TRIFLUOROMETHYL)BICYCLO[1.1.1]PENTAN-1-AMINE HCL, 95% (CAS 262852-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505198-100MG |
| cas | 262852-11-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 500mg | 1257.91 Pln | |
| Fluorochem | 1g | 1893.10 Pln | |
| Fluorochem | 5g | 7464.06 Pln | |
| Fluorochem | 10g | 14867.70 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 262852-11-9) is a chemical compound with the molecular formula C6H9ClF3N and a molecular weight of 187.59 g/mol. IUPAC name: 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: SZJRBVKLWBBKBK-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | SZJRBVKLWBBKBK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)