CAS 262852-11-9 appears in our catalog under these names: 3-(Trifluoromethyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 97%, 3–(Trifluoromethyl)Bicyclo(1·1·1)Pentan–1–Amine Hydrochloride, 3-(Trifluoromethyl)bicyclo(1.1.1)pentan-1-amine HCl, 3-(Trifluoromethyl)bicyclo[1.1.1]pentan-1-amine hydrochloride 98%, 3-(Trifluoromethyl)Bicyclo[1.1.1]Pentan-1-Amine Hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 2g, 5g, 500mg, 10g.
3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 262852-11-9) is a chemical compound with the molecular formula C6H9ClF3N and a molecular weight of 187.59 g/mol. IUPAC name: 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: SZJRBVKLWBBKBK-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | SZJRBVKLWBBKBK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)