3-(Trifluoromethyl)Bicyclo[1.1.1]Pentan-1-Amine Hydrochloride, 98%, 98%
cas: 262852-11-9 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)Bicyclo[1.1.1]Pentan-1-Amine Hydrochloride, 98%, 98% (CAS 262852-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I618-100mg |
| cas | 262852-11-9 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1187.60 Pln | |
| Chemat | 5g | 4739.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 262852-11-9) is a chemical compound with the molecular formula C6H9ClF3N and a molecular weight of 187.59 g/mol. IUPAC name: 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: SZJRBVKLWBBKBK-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | SZJRBVKLWBBKBK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 3-(trifluoromethyl)bicyclo(1.1.1)pentan-1-amine hydrochloride, 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride, SZJRBVKLWBBKBK-UHFFFAOYSA-N, 1-(trifluoromethyl)bicyclo[1.1.1]pentan-3-amine hydrochloride, 1-Amino-3-(trifluoromethyl)bicyclo[1.1.1]pentane Hydrochloride, 3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-aminehydrochloride