cas: 486460-21-3 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine, 97%, 97% (CAS 486460-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BAJ-100mg |
| cas | 486460-21-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 410.00 Pln | |
| Chemat | 25g | 698.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (CAS 486460-21-3) is a chemical compound with the molecular formula C6H7F3N4 and a molecular weight of 192.14 g/mol. IUPAC name: 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: FMTDZGCPYKWMPT-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | FMTDZGCPYKWMPT-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1 |
Computed by PubChem (NCBI)