CAS 1250116-04-1 is the registry number for N2-(2,2,2-Trifluoroethyl)pyrimidine-2,5-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-N-(2,2,2-trifluoroethyl)pyrimidine-2,5-diamine (CAS 1250116-04-1) is a chemical compound with the molecular formula C6H7F3N4 and a molecular weight of 192.14 g/mol. IUPAC name: 2-N-(2,2,2-trifluoroethyl)pyrimidine-2,5-diamine. InChIKey: DNKJGXYIUDKWAV-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 2-N-(2,2,2-trifluoroethyl)pyrimidine-2,5-diamine |
| InChIKey | DNKJGXYIUDKWAV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)NCC(F)(F)F)N |
Computed by PubChem (NCBI)