CAS 1372711-01-7 appears in our catalog under these names: 2-(1-Methylhydrazino)-4-(trifluoromethyl)pyrimidine, 95%, 2-(1-Methylhydrazinyl)-4-(trifluoromethyl)pyrimidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
1-methyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazine (CAS 1372711-01-7) is a chemical compound with the molecular formula C6H7F3N4 and a molecular weight of 192.14 g/mol. IUPAC name: 1-methyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazine. InChIKey: KSHPFMMNRGWDRW-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 1-methyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| InChIKey | KSHPFMMNRGWDRW-UHFFFAOYSA-N |
| SMILES | CN(C1=NC=CC(=N1)C(F)(F)F)N |
Computed by PubChem (NCBI)