cas: 2338-76-3 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenylacetonitrile 96% (CAS 2338-76-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A971508-5g |
| cas | 2338-76-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1010.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A971508 |
2-[3-(trifluoromethyl)phenyl]acetonitrile (CAS 2338-76-3) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]acetonitrile. InChIKey: JOIYKSLWXLFGGR-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | JOIYKSLWXLFGGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CC#N |
Computed by PubChem (NCBI)