cas: 2338-76-3 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)phenylacetonitrile, 96% (CAS 2338-76-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007636-1G |
| cas | 2338-76-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 695.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 96% |
2-[3-(trifluoromethyl)phenyl]acetonitrile (CAS 2338-76-3) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]acetonitrile. InChIKey: JOIYKSLWXLFGGR-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | JOIYKSLWXLFGGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CC#N |
Computed by PubChem (NCBI)