cas: 1951439-59-0 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)quinoline-7-carboxylic acid, 95%, 95% (CAS 1951439-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I47C-100mg |
| cas | 1951439-59-0 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 2267.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)quinoline-7-carboxylic acid (CAS 1951439-59-0) is a chemical compound with the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. IUPAC name: 3-(trifluoromethyl)quinoline-7-carboxylic acid. InChIKey: DNUKXMODJXKWJP-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2 |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)quinoline-7-carboxylic acid |
| InChIKey | DNUKXMODJXKWJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)