Products 1951439-59-0
CAS 1951439-59-0 appears in our catalog under these names: 3-(Trifluoromethyl)quinoline-7-carboxylic acid, 95%, 3-(Trifluoromethyl)quinoline-7-carboxylic acid, 95%, 95%, 3-(TRIFLUOROMETHYL)QUINOLINE-7-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(trifluoromethyl)quinoline-7-carboxylic acid (CAS 1951439-59-0) is a chemical compound with the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. IUPAC name: 3-(trifluoromethyl)quinoline-7-carboxylic acid. InChIKey: DNUKXMODJXKWJP-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2 |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)quinoline-7-carboxylic acid |
| InChIKey | DNUKXMODJXKWJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)