Products 849818-58-2
CAS 849818-58-2 appears in our catalog under these names: 6-(Trifluoromethyl)quinoline-2-carboxylic acid, 95%, 6-(Trifluoromethyl)quinoline-2-carboxylic acid 95%, 6-(TRIFLUOROMETHYL)QUINOLINE-2-CARBOXYLIC ACID, 97%, 6-(Trifluoromethyl)quinoline-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
6-(trifluoromethyl)quinoline-2-carboxylic acid (CAS 849818-58-2) is a chemical compound with the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. IUPAC name: 6-(trifluoromethyl)quinoline-2-carboxylic acid. InChIKey: LSVFVSVUKCIBHC-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2 |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 6-(trifluoromethyl)quinoline-2-carboxylic acid |
| InChIKey | LSVFVSVUKCIBHC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)C(=O)O)C=C1C(F)(F)F |
Computed by PubChem (NCBI)