cas: 213203-84-0 — see every product listed under this CAS number, including other names
3-(Trifluoromethylthio)benzyl bromide (CAS 213203-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008011-1G |
| cas | 213203-84-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1861.86 Pln | |
| Fluorochem | 25g | 5048.24 Pln |
| delivery time | 2-3 weeks |
|---|
1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene (CAS 213203-84-0) is a chemical compound with the molecular formula C8H6BrF3S and a molecular weight of 271.10 g/mol. IUPAC name: 1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene. InChIKey: MPZVFRHSCOOMNG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene |
| InChIKey | MPZVFRHSCOOMNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC(F)(F)F)CBr |
Computed by PubChem (NCBI)