cas: 61537-49-3 — see every product listed under this CAS number, including other names
3-(p-Tolylamino)phenol (CAS 61537-49-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235496-25MG |
| cas | 61537-49-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 190.58 Pln | |
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 500mg | 1008.00 Pln | |
| Fluorochem | 1g | 1247.50 Pln | |
| Fluorochem | 5g | 5938.55 Pln |
| delivery time | 3-4 weeks |
|---|
3-(4-methylanilino)phenol (CAS 61537-49-3) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 3-(4-methylanilino)phenol. InChIKey: TWYLNUMRYUFZIN-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-(4-methylanilino)phenol |
| InChIKey | TWYLNUMRYUFZIN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)