cas: 61537-49-3 — see every product listed under this CAS number, including other names
3-[(4-Methylphenyl)amino]phenol, 97%, 97% (CAS 61537-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9PG-100mg |
| cas | 61537-49-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 1g | 1317.20 Pln | |
| Chemat | 250mg | 688.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(4-methylanilino)phenol (CAS 61537-49-3) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 3-(4-methylanilino)phenol. InChIKey: TWYLNUMRYUFZIN-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-(4-methylanilino)phenol |
| InChIKey | TWYLNUMRYUFZIN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)