cas: 2096331-47-2 — see every product listed under this CAS number, including other names
3-(t-Butyldimethylsilyloxy)-2-fluorophenylboronic acid, 97%, 97% (CAS 2096331-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHO4-100mg |
| cas | 2096331-47-2 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 554.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid (CAS 2096331-47-2) is a chemical compound with the molecular formula C12H20BFO3Si and a molecular weight of 270.18 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid. InChIKey: LARMLYKSRWOEDJ-UHFFFAOYSA-N.
| Molecular formula | C12H20BFO3Si |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid |
| InChIKey | LARMLYKSRWOEDJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)