cas: 1250993-43-1 — see every product listed under this CAS number, including other names
3-(tert-Butoxycarbonyl)-3-azabicyclo(3.2.0)heptane-1-carboxylic acid, 95+% (CAS 1250993-43-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A600190-1g |
| cas | 1250993-43-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 15192.73 Pln | |
| AmBeed | 100mg | 6703.69 Pln | |
| AmBeed | 250mg | 12569.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]heptane-1-carboxylic acid (CAS 1250993-43-1) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]heptane-1-carboxylic acid. InChIKey: HFZDQTVYEXMISZ-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]heptane-1-carboxylic acid |
| InChIKey | HFZDQTVYEXMISZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC2(C1)C(=O)O |
Computed by PubChem (NCBI)