cas: 944906-41-6 — see every product listed under this CAS number, including other names
3-(tert-Butyl)-1,2,4-oxadiazole-5-carboxylic acid, 96% (CAS 944906-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620648-100MG |
| cas | 944906-41-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 3324.89 Pln | |
| Fluorochem | 25g | 14164.82 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid (CAS 944906-41-6) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: KXCQFZZGMDXNGS-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | KXCQFZZGMDXNGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C(=O)O |
Computed by PubChem (NCBI)