cas: 944906-41-6 — see every product listed under this CAS number, including other names
3-Tert-butyl-1,2,4-oxadiazole-5-carboxylic acid, 98%, 98% (CAS 944906-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12CABA-100mg |
| cas | 944906-41-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 914.00 Pln | |
| Chemat | 5g | 2622.80 Pln | |
| Chemat | 10g | 4749.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid (CAS 944906-41-6) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: KXCQFZZGMDXNGS-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | KXCQFZZGMDXNGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C(=O)O |
Computed by PubChem (NCBI)