CAS 944906-41-6 appears in our catalog under these names: 3-tert-Butyl-1,2,4-oxadiazole-5-carboxylic acid, 95%, 3-(tert-Butyl)-1,2,4-oxadiazole-5-carboxylic acid 98%, 3-Tert-butyl-1,2,4-oxadiazole-5-carboxylic acid, 98%, 98%, 3-(tert-Butyl)-1,2,4-oxadiazole-5-carboxylic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg.
3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid (CAS 944906-41-6) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: KXCQFZZGMDXNGS-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-tert-butyl-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | KXCQFZZGMDXNGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C(=O)O |
Computed by PubChem (NCBI)