CAS 7498-54-6 appears in our catalog under these names: 3–(tert–Butyl)benzoic acid, 3-tert-Butylbenzoic acid, 3-(Tert-butyl)benzoic acid, 95%, 95%, 3-tert-Butylbenzoic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
3-tert-butylbenzoic acid (CAS 7498-54-6) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-tert-butylbenzoic acid. InChIKey: PWEJHEZAHNQSHP-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-tert-butylbenzoic acid |
| InChIKey | PWEJHEZAHNQSHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)