cas: 387350-52-9 — see every product listed under this CAS number, including other names
3-[(4,6-Dimethylpyrimidin-2-yl)(methyl)amino]benzoic acid (CAS 387350-52-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023727-1G |
| cas | 387350-52-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1455.76 Pln | |
| Fluorochem | 5g | 1924.34 Pln |
| delivery time | 2-3 weeks |
|---|
3-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid (CAS 387350-52-9) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 3-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid. InChIKey: RBXVYGAOARRNSJ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 3-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid |
| InChIKey | RBXVYGAOARRNSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C2=CC=CC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)