CAS 1935393-12-6 is the registry number for 1,5,6,7-Tetrahydro-pyrazolo[4,3-b]pyridine-4-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Benzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate (CAS 1935393-12-6) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: benzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate. InChIKey: PWYQAPVHBNRXKE-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | benzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate |
| InChIKey | PWYQAPVHBNRXKE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=NN2)N(C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)