CAS 387350-50-7 is the registry number for 4-[(4,6-Dimethylpyrimidin-2-yl)(methyl)amino]benzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g.
4-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid (CAS 387350-50-7) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 4-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid. InChIKey: CWDJNWNZJJKIBB-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 4-[(4,6-dimethylpyrimidin-2-yl)-methylamino]benzoic acid |
| InChIKey | CWDJNWNZJJKIBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)