cas: 1072951-91-7 — see every product listed under this CAS number, including other names
3-[(4-Chloro-3-methylphenoxy)methyl]phenylboronic acid, 95%, 95% (CAS 1072951-91-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IRF-1g |
| cas | 1072951-91-7 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid (CAS 1072951-91-7) is a chemical compound with the molecular formula C14H14BClO3 and a molecular weight of 276.52 g/mol. IUPAC name: [3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid. InChIKey: MLTCJWUQGYLPLF-UHFFFAOYSA-N.
| Molecular formula | C14H14BClO3 |
|---|---|
| Molecular weight | 276.52 g/mol |
| IUPAC name | [3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | MLTCJWUQGYLPLF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC(=C(C=C2)Cl)C)(O)O |
Computed by PubChem (NCBI)