cas: 179174-23-3 — see every product listed under this CAS number, including other names
3-[(4-Nitrobenzene)sulfonamido]propanoic acid, ≥95%, ≥95% (CAS 179174-23-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1137U5-250mg |
| cas | 179174-23-3 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1115.60 Pln | |
| Chemat | 5g | 5339.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-[(4-nitrophenyl)sulfonylamino]propanoic acid (CAS 179174-23-3) is a chemical compound with the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. IUPAC name: 3-[(4-nitrophenyl)sulfonylamino]propanoic acid. InChIKey: WBULOUVRHAKHDN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O6S |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)sulfonylamino]propanoic acid |
| InChIKey | WBULOUVRHAKHDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)