Products 953907-19-2
CAS 953907-19-2 appears in our catalog under these names: 3-[(3-Nitrobenzene)sulfonamido]propanoic acid, 98%, 3-(3-Nitrophenylsulfonamido)propanoic acid, 98%, 3-(3-nitrobenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g.
3-[(3-nitrophenyl)sulfonylamino]propanoic acid (CAS 953907-19-2) is a chemical compound with the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. IUPAC name: 3-[(3-nitrophenyl)sulfonylamino]propanoic acid. InChIKey: ZCGJFIPBEYNNCQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O6S |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | 3-[(3-nitrophenyl)sulfonylamino]propanoic acid |
| InChIKey | ZCGJFIPBEYNNCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)