CAS 179174-23-3 appears in our catalog under these names: 3-(4-nitrobenzenesulfonamido)propanoic acid, 3-[(4-Nitrobenzene)sulfonamido]propanoic acid, 98%, 3-((4-Nitrophenyl)sulfonamido)propanoic acid, 98%, 3-[(4-Nitrobenzene)sulfonamido]propanoic acid, ≥95%, ≥95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 0,5g, 250mg, 10g, 1g.
3-[(4-nitrophenyl)sulfonylamino]propanoic acid (CAS 179174-23-3) is a chemical compound with the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. IUPAC name: 3-[(4-nitrophenyl)sulfonylamino]propanoic acid. InChIKey: WBULOUVRHAKHDN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O6S |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)sulfonylamino]propanoic acid |
| InChIKey | WBULOUVRHAKHDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)