cas: 1638765-30-6 — see every product listed under this CAS number, including other names
3-[(TERT-BUTOXY)CARBONYL]BICYCLO[1.1.1]PENTANE-1-CARBOXYLIC ACID, 97% (CAS 1638765-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504362-100MG |
| cas | 1638765-30-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 500mg | 763.29 Pln | |
| Fluorochem | 1g | 1112.13 Pln | |
| Fluorochem | 5g | 3184.31 Pln | |
| Fluorochem | 10g | 5235.67 Pln | |
| Fluorochem | 25g | 10410.94 Pln | |
| Fluorochem | 100g | 24249.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1638765-30-6) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: GWMJQGGVPOMUAO-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | GWMJQGGVPOMUAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CC(C1)(C2)C(=O)O |
Computed by PubChem (NCBI)